About 1-[1-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]imidazol-4-yl]propan-2-amine
1-[1-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]imidazol-4-yl]propan-2-amine (PubChem CID 106721221) has the molecular formula C14H19N5O2
and a molecular weight of 289.34 g/mol. Its IUPAC name is 1-[1-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]imidazol-4-yl]propan-2-amine.
Molecular Properties
| Compound Name | 1-[1-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]imidazol-4-yl]propan-2-amine |
| PubChem CID | 106721221 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1-[1-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]imidazol-4-yl]propan-2-amine |
| SMILES | Cc1cnc(Cn2cnc(CC(C)N)c2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19N5O2/c1-9-5-16-13(11(3)14(9)19(20)21)7-18-6-12(17-8-18)4-10(2)15/h5-6,8,10H,4,7,15H2,1-3H3 |
| InChIKey | IQIFBNKDMUYRBH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]imidazol-4-yl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]imidazol-4-yl]propan-2-amine?
The IUPAC name of 1-[1-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]imidazol-4-yl]propan-2-amine (CID 106721221) is 1-[1-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]imidazol-4-yl]propan-2-amine.
What is the SMILES notation for 1-[1-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]imidazol-4-yl]propan-2-amine?
The canonical SMILES for 1-[1-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]imidazol-4-yl]propan-2-amine is Cc1cnc(Cn2cnc(CC(C)N)c2)c(C)c1[N+](=O)[O-].
What is the InChIKey of 1-[1-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]imidazol-4-yl]propan-2-amine?
The InChIKey is IQIFBNKDMUYRBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5O2/c1-9-5-16-13(11(3)14(9)19(20)21)7-18-6-12(17-8-18)4-10(2)15/h5-6,8,10H,4,7,15H2,1-3H3.
What are the key properties of 1-[1-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]imidazol-4-yl]propan-2-amine?
1-[1-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]imidazol-4-yl]propan-2-amine has a molecular weight of 289.34 g/mol, XLogP of 1.74, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]imidazol-4-yl]propan-2-amine is sourced from PubChem (CID 106721221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).