C12H15F2NO4S — CID 106723033
2,2-difluoro-N-(2-propylsulfonylethyl)-1,3-benzodioxol-5-amine (PubChem CID 106723033) has the molecular formula C12H15F2NO4S and a molecular weight of 307.32 g/mol. Its IUPAC name is 2,2-difluoro-N-(2-propylsulfonylethyl)-1,3-benzodioxol-5-amine.
| Compound Name | 2,2-difluoro-N-(2-propylsulfonylethyl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 106723033 |
| Molecular Formula | C12H15F2NO4S |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 2,2-difluoro-N-(2-propylsulfonylethyl)-1,3-benzodioxol-5-amine |
| SMILES | CCCS(=O)(=O)CCNc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C12H15F2NO4S/c1-2-6-20(16,17)7-5-15-9-3-4-10-11(8-9)19-12(13,14)18-10/h3-4,8,15H,2,5-7H2,1H3 |
| InChIKey | KXXQXWYTEHZHAX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|