C33H34N4O4 — CID 1067277
2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2,4-dimethoxyphenyl)carbamoylamino]-N-(2-phenylethyl)benzamide (PubChem CID 1067277) has the molecular formula C33H34N4O4 and a molecular weight of 550.66 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2,4-dimethoxyphenyl)carbamoylamino]-N-(2-phenylethyl)benzamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2,4-dimethoxyphenyl)carbamoylamino]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 1067277 |
| Molecular Formula | C33H34N4O4 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2,4-dimethoxyphenyl)carbamoylamino]-N-(2-phenylethyl)benzamide |
| SMILES | COc1ccc(NC(=O)Nc2ccc(N3CCc4ccccc4C3)c(C(=O)NCCc3ccccc3)c2)c(OC)c1 |
| InChI | InChI=1S/C33H34N4O4/c1-40-27-13-14-29(31(21-27)41-2)36-33(39)35-26-12-15-30(37-19-17-24-10-6-7-11-25(24)22-37)28(20-26)32(38)34-18-16-23-8-4-3-5-9-23/h3-15,20-21H,16-19,22H2,1-2H3,(H,34,38)(H2,35,36,39) |
| InChIKey | GXVFOXHKSXMOMW-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|