C16H26ClNO2S — CID 106730140
4-tert-butylsulfonyl-2-(4-chlorophenyl)-N-ethylbutan-1-amine (PubChem CID 106730140) has the molecular formula C16H26ClNO2S and a molecular weight of 331.91 g/mol. Its IUPAC name is 4-tert-butylsulfonyl-2-(4-chlorophenyl)-N-ethylbutan-1-amine.
| Compound Name | 4-tert-butylsulfonyl-2-(4-chlorophenyl)-N-ethylbutan-1-amine |
|---|---|
| PubChem CID | 106730140 |
| Molecular Formula | C16H26ClNO2S |
| Molecular Weight | 331.91 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 4-tert-butylsulfonyl-2-(4-chlorophenyl)-N-ethylbutan-1-amine |
| SMILES | CCNCC(CCS(=O)(=O)C(C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H26ClNO2S/c1-5-18-12-14(13-6-8-15(17)9-7-13)10-11-21(19,20)16(2,3)4/h6-9,14,18H,5,10-12H2,1-4H3 |
| InChIKey | GASXLBMKIILAGO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.91 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |