C15H24ClNO2S — CID 79438198
N-tert-butyl-2-(4-chlorophenyl)-4-methylsulfonylbutan-1-amine (PubChem CID 79438198) has the molecular formula C15H24ClNO2S and a molecular weight of 317.88 g/mol. Its IUPAC name is N-tert-butyl-2-(4-chlorophenyl)-4-methylsulfonylbutan-1-amine.
| Compound Name | N-tert-butyl-2-(4-chlorophenyl)-4-methylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 79438198 |
| Molecular Formula | C15H24ClNO2S |
| Molecular Weight | 317.88 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-tert-butyl-2-(4-chlorophenyl)-4-methylsulfonylbutan-1-amine |
| SMILES | CC(C)(C)NCC(CCS(C)(=O)=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H24ClNO2S/c1-15(2,3)17-11-13(9-10-20(4,18)19)12-5-7-14(16)8-6-12/h5-8,13,17H,9-11H2,1-4H3 |
| InChIKey | ULSKOBHDSYWUPS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.88 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |