C12H25NO2S — CID 106730434
N-ethyl-2-methyl-2-(2-propan-2-ylsulfonylethyl)but-3-en-1-amine (PubChem CID 106730434) has the molecular formula C12H25NO2S and a molecular weight of 247.40 g/mol. Its IUPAC name is N-ethyl-2-methyl-2-(2-propan-2-ylsulfonylethyl)but-3-en-1-amine.
| Compound Name | N-ethyl-2-methyl-2-(2-propan-2-ylsulfonylethyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 106730434 |
| Molecular Formula | C12H25NO2S |
| Molecular Weight | 247.40 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | N-ethyl-2-methyl-2-(2-propan-2-ylsulfonylethyl)but-3-en-1-amine |
| SMILES | C=CC(C)(CCS(=O)(=O)C(C)C)CNCC |
| InChI | InChI=1S/C12H25NO2S/c1-6-12(5,10-13-7-2)8-9-16(14,15)11(3)4/h6,11,13H,1,7-10H2,2-5H3 |
| InChIKey | LGFPBKFWPJIQIR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|