C15H23BrO2S — CID 106734651
1-(1-bromo-4-tert-butylsulfonylbutan-2-yl)-3-methylbenzene (PubChem CID 106734651) has the molecular formula C15H23BrO2S and a molecular weight of 347.32 g/mol. Its IUPAC name is 1-(1-bromo-4-tert-butylsulfonylbutan-2-yl)-3-methylbenzene.
| Compound Name | 1-(1-bromo-4-tert-butylsulfonylbutan-2-yl)-3-methylbenzene |
|---|---|
| PubChem CID | 106734651 |
| Molecular Formula | C15H23BrO2S |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 1-(1-bromo-4-tert-butylsulfonylbutan-2-yl)-3-methylbenzene |
| SMILES | Cc1cccc(C(CBr)CCS(=O)(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C15H23BrO2S/c1-12-6-5-7-13(10-12)14(11-16)8-9-19(17,18)15(2,3)4/h5-7,10,14H,8-9,11H2,1-4H3 |
| InChIKey | ALVFDHOOASWWFN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|