C11H14Br2O3S — CID 102550411
2,2-dibromo-2-ethylsulfonyl-1-(3-methylphenyl)ethanol (PubChem CID 102550411) has the molecular formula C11H14Br2O3S and a molecular weight of 386.11 g/mol. Its IUPAC name is 2,2-dibromo-2-ethylsulfonyl-1-(3-methylphenyl)ethanol.
| Compound Name | 2,2-dibromo-2-ethylsulfonyl-1-(3-methylphenyl)ethanol |
|---|---|
| PubChem CID | 102550411 |
| Molecular Formula | C11H14Br2O3S |
| Molecular Weight | 386.11 g/mol |
| Exact Mass | 383.90 |
| IUPAC Name | 2,2-dibromo-2-ethylsulfonyl-1-(3-methylphenyl)ethanol |
| SMILES | CCS(=O)(=O)C(Br)(Br)C(O)c1cccc(C)c1 |
| InChI | InChI=1S/C11H14Br2O3S/c1-3-17(15,16)11(12,13)10(14)9-6-4-5-8(2)7-9/h4-7,10,14H,3H2,1-2H3 |
| InChIKey | BBYDFYHOFCYHDF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.11 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|