C14H18Cl2N2O — CID 106738532
N-(2,6-dichloro-3-methylphenyl)-2-methylpiperidine-4-carboxamide (PubChem CID 106738532) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is N-(2,6-dichloro-3-methylphenyl)-2-methylpiperidine-4-carboxamide.
| Compound Name | N-(2,6-dichloro-3-methylphenyl)-2-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 106738532 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N-(2,6-dichloro-3-methylphenyl)-2-methylpiperidine-4-carboxamide |
| SMILES | Cc1ccc(Cl)c(NC(=O)C2CCNC(C)C2)c1Cl |
| InChI | InChI=1S/C14H18Cl2N2O/c1-8-3-4-11(15)13(12(8)16)18-14(19)10-5-6-17-9(2)7-10/h3-4,9-10,17H,5-7H2,1-2H3,(H,18,19) |
| InChIKey | XTNXMWRHHJGVNB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |