C9H16N2O4 — CID 106740682
2-[(2-methylpiperidine-4-carbonyl)amino]oxyacetic acid (PubChem CID 106740682) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-[(2-methylpiperidine-4-carbonyl)amino]oxyacetic acid.
| Compound Name | 2-[(2-methylpiperidine-4-carbonyl)amino]oxyacetic acid |
|---|---|
| PubChem CID | 106740682 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 2-[(2-methylpiperidine-4-carbonyl)amino]oxyacetic acid |
| SMILES | CC1CC(C(=O)NOCC(=O)O)CCN1 |
| InChI | InChI=1S/C9H16N2O4/c1-6-4-7(2-3-10-6)9(14)11-15-5-8(12)13/h6-7,10H,2-5H2,1H3,(H,11,14)(H,12,13) |
| InChIKey | CDHGUMOBYXDINB-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|