C33H44O5Si — CID 10674193
(2R,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,6-tris(phenylmethoxy)hexanal (PubChem CID 10674193) has the molecular formula C33H44O5Si and a molecular weight of 548.80 g/mol. Its IUPAC name is (2R,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,6-tris(phenylmethoxy)hexanal.
| Compound Name | (2R,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,6-tris(phenylmethoxy)hexanal |
|---|---|
| PubChem CID | 10674193 |
| Molecular Formula | C33H44O5Si |
| Molecular Weight | 548.80 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | (2R,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,6-tris(phenylmethoxy)hexanal |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](COCc1ccccc1)C[C@H](OCc1ccccc1)[C@H](C=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H44O5Si/c1-33(2,3)39(4,5)38-30(26-35-23-27-15-9-6-10-16-27)21-31(36-24-28-17-11-7-12-18-28)32(22-34)37-25-29-19-13-8-14-20-29/h6-20,22,30-32H,21,23-26H2,1-5H3/t30-,31-,32-/m0/s1 |
| InChIKey | FQSDIRVHVCAVFR-CPCREDONSA-N |
| XLogP | 7.35 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.80 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|