C30H19F5N2O3 — CID 10674222
[5-[[5-(4-methoxybenzoyl)-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-phenylmethanone (PubChem CID 10674222) has the molecular formula C30H19F5N2O3 and a molecular weight of 550.48 g/mol. Its IUPAC name is [5-[[5-(4-methoxybenzoyl)-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-phenylmethanone.
| Compound Name | [5-[[5-(4-methoxybenzoyl)-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 10674222 |
| Molecular Formula | C30H19F5N2O3 |
| Molecular Weight | 550.48 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | [5-[[5-(4-methoxybenzoyl)-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-phenylmethanone |
| SMILES | COc1ccc(C(=O)c2ccc(C(c3ccc(C(=O)c4ccccc4)[nH]3)c3c(F)c(F)c(F)c(F)c3F)[nH]2)cc1 |
| InChI | InChI=1S/C30H19F5N2O3/c1-40-17-9-7-16(8-10-17)30(39)21-14-12-19(37-21)22(23-24(31)26(33)28(35)27(34)25(23)32)18-11-13-20(36-18)29(38)15-5-3-2-4-6-15/h2-14,22,36-37H,1H3 |
| InChIKey | YOLMJIONNUPEON-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.48 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|