C12H21NO3 — CID 106745187
2-methyl-1-(oxan-4-yl)piperidine-4-carboxylic acid (PubChem CID 106745187) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 2-methyl-1-(oxan-4-yl)piperidine-4-carboxylic acid.
| Compound Name | 2-methyl-1-(oxan-4-yl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 106745187 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2-methyl-1-(oxan-4-yl)piperidine-4-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CCN1C1CCOCC1 |
| InChI | InChI=1S/C12H21NO3/c1-9-8-10(12(14)15)2-5-13(9)11-3-6-16-7-4-11/h9-11H,2-8H2,1H3,(H,14,15) |
| InChIKey | CFWBMOJROITMSL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |