C10H17NO4 — CID 67774938
(2S,4R)-4-hydroxy-1-(oxan-4-yl)pyrrolidine-2-carboxylic acid (PubChem CID 67774938) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is (2S,4R)-4-hydroxy-1-(oxan-4-yl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-4-hydroxy-1-(oxan-4-yl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 67774938 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | (2S,4R)-4-hydroxy-1-(oxan-4-yl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@@H](O)CN1C1CCOCC1 |
| InChI | InChI=1S/C10H17NO4/c12-8-5-9(10(13)14)11(6-8)7-1-3-15-4-2-7/h7-9,12H,1-6H2,(H,13,14)/t8-,9+/m1/s1 |
| InChIKey | IXOOECPQXNVDSX-BDAKNGLRSA-N |
| XLogP | -0.31 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |