C11H21N3O2 — CID 162453191
(2R,4R)-1-(4-aminocyclohexyl)-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 162453191) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is (2R,4R)-1-(4-aminocyclohexyl)-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | (2R,4R)-1-(4-aminocyclohexyl)-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 162453191 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | (2R,4R)-1-(4-aminocyclohexyl)-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@H]1C[C@@H](O)CN1C1CCC(N)CC1 |
| InChI | InChI=1S/C11H21N3O2/c12-7-1-3-8(4-2-7)14-6-9(15)5-10(14)11(13)16/h7-10,15H,1-6,12H2,(H2,13,16)/t7?,8?,9-,10-/m1/s1 |
| InChIKey | UNHURJQXWDSIDR-YDYPAMBWSA-N |
| XLogP | -0.82 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |