C14H19BF3KN2 — CID 106745610
potassium trifluoro-[3-[4-(3-methylphenyl)piperazin-1-yl]prop-1-en-2-yl]boranuide (PubChem CID 106745610) has the molecular formula C14H19BF3KN2 and a molecular weight of 322.22 g/mol. Its IUPAC name is potassium trifluoro-[3-[4-(3-methylphenyl)piperazin-1-yl]prop-1-en-2-yl]boranuide.
| Compound Name | potassium trifluoro-[3-[4-(3-methylphenyl)piperazin-1-yl]prop-1-en-2-yl]boranuide |
|---|---|
| PubChem CID | 106745610 |
| Molecular Formula | C14H19BF3KN2 |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | potassium trifluoro-[3-[4-(3-methylphenyl)piperazin-1-yl]prop-1-en-2-yl]boranuide |
| SMILES | C=C(CN1CCN(c2cccc(C)c2)CC1)[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C14H19BF3N2.K/c1-12-4-3-5-14(10-12)20-8-6-19(7-9-20)11-13(2)15(16,17)18;/h3-5,10H,2,6-9,11H2,1H3;/q-1;+1 |
| InChIKey | DCANZLBMOOAGTP-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|