C9H16BF3N- — CID 106746056
3-(2,2-dimethylpyrrolidin-1-yl)prop-1-en-2-yl-trifluoroboranuide (PubChem CID 106746056) has the molecular formula C9H16BF3N- and a molecular weight of 206.04 g/mol. Its IUPAC name is 3-(2,2-dimethylpyrrolidin-1-yl)prop-1-en-2-yl-trifluoroboranuide.
| Compound Name | 3-(2,2-dimethylpyrrolidin-1-yl)prop-1-en-2-yl-trifluoroboranuide |
|---|---|
| PubChem CID | 106746056 |
| Molecular Formula | C9H16BF3N- |
| Molecular Weight | 206.04 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 3-(2,2-dimethylpyrrolidin-1-yl)prop-1-en-2-yl-trifluoroboranuide |
| SMILES | C=C(CN1CCCC1(C)C)[B-](F)(F)F |
| InChI | InChI=1S/C9H16BF3N/c1-8(10(11,12)13)7-14-6-4-5-9(14,2)3/h1,4-7H2,2-3H3/q-1 |
| InChIKey | SFLAPKDRFSXRJR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.04 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|