C9H13F2N3 — CID 106751196
4-N-(2,2-difluoroethyl)-4-N-methylbenzene-1,2,4-triamine (PubChem CID 106751196) has the molecular formula C9H13F2N3 and a molecular weight of 201.22 g/mol. Its IUPAC name is 4-N-(2,2-difluoroethyl)-4-N-methylbenzene-1,2,4-triamine.
| Compound Name | 4-N-(2,2-difluoroethyl)-4-N-methylbenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 106751196 |
| Molecular Formula | C9H13F2N3 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | 4-N-(2,2-difluoroethyl)-4-N-methylbenzene-1,2,4-triamine |
| SMILES | CN(CC(F)F)c1ccc(N)c(N)c1 |
| InChI | InChI=1S/C9H13F2N3/c1-14(5-9(10)11)6-2-3-7(12)8(13)4-6/h2-4,9H,5,12-13H2,1H3 |
| InChIKey | ZAHUXQOVSTZJAX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|