C12H17N3 — CID 62912327
3-(3-amino-N,4-dimethylanilino)-2-methylpropanenitrile (PubChem CID 62912327) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 3-(3-amino-N,4-dimethylanilino)-2-methylpropanenitrile.
| Compound Name | 3-(3-amino-N,4-dimethylanilino)-2-methylpropanenitrile |
|---|---|
| PubChem CID | 62912327 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 3-(3-amino-N,4-dimethylanilino)-2-methylpropanenitrile |
| SMILES | Cc1ccc(N(C)CC(C)C#N)cc1N |
| InChI | InChI=1S/C12H17N3/c1-9(7-13)8-15(3)11-5-4-10(2)12(14)6-11/h4-6,9H,8,14H2,1-3H3 |
| InChIKey | CVAOHDYYARKUHV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|