C16H25N3O4 — CID 106758302
tert-butyl 3-methyl-5-[2-(2-methylpyrazol-3-yl)-2-oxoethyl]morpholine-4-carboxylate (PubChem CID 106758302) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is tert-butyl 3-methyl-5-[2-(2-methylpyrazol-3-yl)-2-oxoethyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-methyl-5-[2-(2-methylpyrazol-3-yl)-2-oxoethyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 106758302 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | tert-butyl 3-methyl-5-[2-(2-methylpyrazol-3-yl)-2-oxoethyl]morpholine-4-carboxylate |
| SMILES | CC1COCC(CC(=O)c2ccnn2C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25N3O4/c1-11-9-22-10-12(19(11)15(21)23-16(2,3)4)8-14(20)13-6-7-17-18(13)5/h6-7,11-12H,8-10H2,1-5H3 |
| InChIKey | PVWBNQYZTCJVJU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |