C12H15N5O — CID 106760594
5-amino-N-[2-(dimethylamino)phenyl]-1H-pyrazole-4-carboxamide (PubChem CID 106760594) has the molecular formula C12H15N5O and a molecular weight of 245.29 g/mol. Its IUPAC name is 5-amino-N-[2-(dimethylamino)phenyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-amino-N-[2-(dimethylamino)phenyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 106760594 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 5-amino-N-[2-(dimethylamino)phenyl]-1H-pyrazole-4-carboxamide |
| SMILES | CN(C)c1ccccc1NC(=O)c1cn[nH]c1N |
| InChI | InChI=1S/C12H15N5O/c1-17(2)10-6-4-3-5-9(10)15-12(18)8-7-14-16-11(8)13/h3-7H,1-2H3,(H,15,18)(H3,13,14,16) |
| InChIKey | RSPISFWOJDCVMG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |