C10H8Br2N4O — CID 61475532
5-amino-N-(2,4-dibromophenyl)-1H-pyrazole-4-carboxamide (PubChem CID 61475532) has the molecular formula C10H8Br2N4O and a molecular weight of 360.01 g/mol. Its IUPAC name is 5-amino-N-(2,4-dibromophenyl)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-amino-N-(2,4-dibromophenyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 61475532 |
| Molecular Formula | C10H8Br2N4O |
| Molecular Weight | 360.01 g/mol |
| Exact Mass | 357.91 |
| IUPAC Name | 5-amino-N-(2,4-dibromophenyl)-1H-pyrazole-4-carboxamide |
| SMILES | Nc1[nH]ncc1C(=O)Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C10H8Br2N4O/c11-5-1-2-8(7(12)3-5)15-10(17)6-4-14-16-9(6)13/h1-4H,(H,15,17)(H3,13,14,16) |
| InChIKey | AHQLHBBHXNEJKJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.01 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |