C10H9IN4O — CID 43159637
5-amino-N-(4-iodophenyl)-1H-pyrazole-4-carboxamide (PubChem CID 43159637) has the molecular formula C10H9IN4O and a molecular weight of 328.11 g/mol. Its IUPAC name is 5-amino-N-(4-iodophenyl)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-amino-N-(4-iodophenyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 43159637 |
| Molecular Formula | C10H9IN4O |
| Molecular Weight | 328.11 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 5-amino-N-(4-iodophenyl)-1H-pyrazole-4-carboxamide |
| SMILES | Nc1[nH]ncc1C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C10H9IN4O/c11-6-1-3-7(4-2-6)14-10(16)8-5-13-15-9(8)12/h1-5H,(H,14,16)(H3,12,13,15) |
| InChIKey | LECVMBFBBUFSTQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.11 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|