C15H15BrClFN2 — CID 106763291
N-[[5-(4-bromo-3-chloro-2-fluorophenyl)-3-pyridinyl]methyl]propan-1-amine (PubChem CID 106763291) has the molecular formula C15H15BrClFN2 and a molecular weight of 357.65 g/mol. Its IUPAC name is N-[[5-(4-bromo-3-chloro-2-fluorophenyl)-3-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[5-(4-bromo-3-chloro-2-fluorophenyl)-3-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 106763291 |
| Molecular Formula | C15H15BrClFN2 |
| Molecular Weight | 357.65 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | N-[[5-(4-bromo-3-chloro-2-fluorophenyl)-3-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cncc(-c2ccc(Br)c(Cl)c2F)c1 |
| InChI | InChI=1S/C15H15BrClFN2/c1-2-5-19-7-10-6-11(9-20-8-10)12-3-4-13(16)14(17)15(12)18/h3-4,6,8-9,19H,2,5,7H2,1H3 |
| InChIKey | XHWMVJKBYFXCKX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|