C11H15ClF3N3S — CID 106768420
6-chloro-N-methyl-N-(4-methylsulfanylbutan-2-yl)-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106768420) has the molecular formula C11H15ClF3N3S and a molecular weight of 313.78 g/mol. Its IUPAC name is 6-chloro-N-methyl-N-(4-methylsulfanylbutan-2-yl)-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-N-methyl-N-(4-methylsulfanylbutan-2-yl)-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106768420 |
| Molecular Formula | C11H15ClF3N3S |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 6-chloro-N-methyl-N-(4-methylsulfanylbutan-2-yl)-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CSCCC(C)N(C)c1cc(Cl)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H15ClF3N3S/c1-7(4-5-19-3)18(2)9-6-8(12)16-10(17-9)11(13,14)15/h6-7H,4-5H2,1-3H3 |
| InChIKey | DMPNBUFEWVXMNK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |