C17H21ClN2O — CID 106769214
4-(chloromethyl)-1-[4-(methoxymethyl)piperidin-1-yl]isoquinoline (PubChem CID 106769214) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is 4-(chloromethyl)-1-[4-(methoxymethyl)piperidin-1-yl]isoquinoline.
| Compound Name | 4-(chloromethyl)-1-[4-(methoxymethyl)piperidin-1-yl]isoquinoline |
|---|---|
| PubChem CID | 106769214 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 4-(chloromethyl)-1-[4-(methoxymethyl)piperidin-1-yl]isoquinoline |
| SMILES | COCC1CCN(c2ncc(CCl)c3ccccc23)CC1 |
| InChI | InChI=1S/C17H21ClN2O/c1-21-12-13-6-8-20(9-7-13)17-16-5-3-2-4-15(16)14(10-18)11-19-17/h2-5,11,13H,6-10,12H2,1H3 |
| InChIKey | QXFWNCPHHLUXSI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|