C17H22ClN3 — CID 106769194
4-(chloromethyl)-1-(4-ethyl-3-methylpiperazin-1-yl)isoquinoline (PubChem CID 106769194) has the molecular formula C17H22ClN3 and a molecular weight of 303.84 g/mol. Its IUPAC name is 4-(chloromethyl)-1-(4-ethyl-3-methylpiperazin-1-yl)isoquinoline.
| Compound Name | 4-(chloromethyl)-1-(4-ethyl-3-methylpiperazin-1-yl)isoquinoline |
|---|---|
| PubChem CID | 106769194 |
| Molecular Formula | C17H22ClN3 |
| Molecular Weight | 303.84 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 4-(chloromethyl)-1-(4-ethyl-3-methylpiperazin-1-yl)isoquinoline |
| SMILES | CCN1CCN(c2ncc(CCl)c3ccccc23)CC1C |
| InChI | InChI=1S/C17H22ClN3/c1-3-20-8-9-21(12-13(20)2)17-16-7-5-4-6-15(16)14(10-18)11-19-17/h4-7,11,13H,3,8-10,12H2,1-2H3 |
| InChIKey | RYUWZSXYVJMFSU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.84 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|