C12H14F3N5S — CID 106774979
6-(1-methylimidazol-2-yl)sulfanyl-N-propyl-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106774979) has the molecular formula C12H14F3N5S and a molecular weight of 317.34 g/mol. Its IUPAC name is 6-(1-methylimidazol-2-yl)sulfanyl-N-propyl-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-(1-methylimidazol-2-yl)sulfanyl-N-propyl-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106774979 |
| Molecular Formula | C12H14F3N5S |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 6-(1-methylimidazol-2-yl)sulfanyl-N-propyl-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CCCNc1cc(Sc2nccn2C)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H14F3N5S/c1-3-4-16-8-7-9(19-10(18-8)12(13,14)15)21-11-17-5-6-20(11)2/h5-7H,3-4H2,1-2H3,(H,16,18,19) |
| InChIKey | MCYQUWGXXBHLCH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |