C13H13F3N4S — CID 106774883
N-propyl-6-pyridin-2-ylsulfanyl-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106774883) has the molecular formula C13H13F3N4S and a molecular weight of 314.34 g/mol. Its IUPAC name is N-propyl-6-pyridin-2-ylsulfanyl-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-propyl-6-pyridin-2-ylsulfanyl-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106774883 |
| Molecular Formula | C13H13F3N4S |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | N-propyl-6-pyridin-2-ylsulfanyl-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CCCNc1cc(Sc2ccccn2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H13F3N4S/c1-2-6-17-9-8-11(20-12(19-9)13(14,15)16)21-10-5-3-4-7-18-10/h3-5,7-8H,2,6H2,1H3,(H,17,19,20) |
| InChIKey | XMCZQFSKFGTNBU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |