C13H16N4S2 — CID 80882787
2-methylsulfanyl-N-propyl-6-pyridin-2-ylsulfanylpyrimidin-4-amine (PubChem CID 80882787) has the molecular formula C13H16N4S2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 2-methylsulfanyl-N-propyl-6-pyridin-2-ylsulfanylpyrimidin-4-amine.
| Compound Name | 2-methylsulfanyl-N-propyl-6-pyridin-2-ylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80882787 |
| Molecular Formula | C13H16N4S2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 2-methylsulfanyl-N-propyl-6-pyridin-2-ylsulfanylpyrimidin-4-amine |
| SMILES | CCCNc1cc(Sc2ccccn2)nc(SC)n1 |
| InChI | InChI=1S/C13H16N4S2/c1-3-7-14-10-9-12(17-13(16-10)18-2)19-11-6-4-5-8-15-11/h4-6,8-9H,3,7H2,1-2H3,(H,14,16,17) |
| InChIKey | PGGGVIRRCKWENT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |