C15H20N4OS — CID 80846370
2-methylsulfanyl-N-propyl-6-(2-pyridin-2-ylethoxy)pyrimidin-4-amine (PubChem CID 80846370) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is 2-methylsulfanyl-N-propyl-6-(2-pyridin-2-ylethoxy)pyrimidin-4-amine.
| Compound Name | 2-methylsulfanyl-N-propyl-6-(2-pyridin-2-ylethoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80846370 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-methylsulfanyl-N-propyl-6-(2-pyridin-2-ylethoxy)pyrimidin-4-amine |
| SMILES | CCCNc1cc(OCCc2ccccn2)nc(SC)n1 |
| InChI | InChI=1S/C15H20N4OS/c1-3-8-17-13-11-14(19-15(18-13)21-2)20-10-7-12-6-4-5-9-16-12/h4-6,9,11H,3,7-8,10H2,1-2H3,(H,17,18,19) |
| InChIKey | CKSMVIGFAZNIPO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |