C13H23N3S2 — CID 107765595
6-(3-methylbutan-2-ylsulfanyl)-2-methylsulfanyl-N-propylpyrimidin-4-amine (PubChem CID 107765595) has the molecular formula C13H23N3S2 and a molecular weight of 285.48 g/mol. Its IUPAC name is 6-(3-methylbutan-2-ylsulfanyl)-2-methylsulfanyl-N-propylpyrimidin-4-amine.
| Compound Name | 6-(3-methylbutan-2-ylsulfanyl)-2-methylsulfanyl-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107765595 |
| Molecular Formula | C13H23N3S2 |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 6-(3-methylbutan-2-ylsulfanyl)-2-methylsulfanyl-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1cc(SC(C)C(C)C)nc(SC)n1 |
| InChI | InChI=1S/C13H23N3S2/c1-6-7-14-11-8-12(16-13(15-11)17-5)18-10(4)9(2)3/h8-10H,6-7H2,1-5H3,(H,14,15,16) |
| InChIKey | IZMXKPMNRZYENN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |