C17H19N — CID 106777836
5-(2-phenylethyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 106777836) has the molecular formula C17H19N and a molecular weight of 237.35 g/mol. Its IUPAC name is 5-(2-phenylethyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 5-(2-phenylethyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 106777836 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 5-(2-phenylethyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1ccc(CCc2cccc3c2CCCN3)cc1 |
| InChI | InChI=1S/C17H19N/c1-2-6-14(7-3-1)11-12-15-8-4-10-17-16(15)9-5-13-18-17/h1-4,6-8,10,18H,5,9,11-13H2 |
| InChIKey | NGAGBMTYJRWYHQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |