C15H15NO — CID 69017976
2-(1,2,3,4-tetrahydroquinolin-5-yl)phenol (PubChem CID 69017976) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-(1,2,3,4-tetrahydroquinolin-5-yl)phenol.
| Compound Name | 2-(1,2,3,4-tetrahydroquinolin-5-yl)phenol |
|---|---|
| PubChem CID | 69017976 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-(1,2,3,4-tetrahydroquinolin-5-yl)phenol |
| SMILES | Oc1ccccc1-c1cccc2c1CCCN2 |
| InChI | InChI=1S/C15H15NO/c17-15-9-2-1-5-13(15)11-6-3-8-14-12(11)7-4-10-16-14/h1-3,5-6,8-9,16-17H,4,7,10H2 |
| InChIKey | VQNPWFBPXNMXEB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |