C14H24F3N — CID 106779481
2-(3,5-dimethylcyclohexyl)-3-(trifluoromethyl)piperidine (PubChem CID 106779481) has the molecular formula C14H24F3N and a molecular weight of 263.35 g/mol. Its IUPAC name is 2-(3,5-dimethylcyclohexyl)-3-(trifluoromethyl)piperidine.
| Compound Name | 2-(3,5-dimethylcyclohexyl)-3-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 106779481 |
| Molecular Formula | C14H24F3N |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 2-(3,5-dimethylcyclohexyl)-3-(trifluoromethyl)piperidine |
| SMILES | CC1CC(C)CC(C2NCCCC2C(F)(F)F)C1 |
| InChI | InChI=1S/C14H24F3N/c1-9-6-10(2)8-11(7-9)13-12(14(15,16)17)4-3-5-18-13/h9-13,18H,3-8H2,1-2H3 |
| InChIKey | GAPZPDODTSSMNS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |