C16H23NO2 — CID 106779789
1-[3-(oxolan-2-yl)propyl]-1,2,3,4-tetrahydroisoquinolin-7-ol (PubChem CID 106779789) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 1-[3-(oxolan-2-yl)propyl]-1,2,3,4-tetrahydroisoquinolin-7-ol.
| Compound Name | 1-[3-(oxolan-2-yl)propyl]-1,2,3,4-tetrahydroisoquinolin-7-ol |
|---|---|
| PubChem CID | 106779789 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 1-[3-(oxolan-2-yl)propyl]-1,2,3,4-tetrahydroisoquinolin-7-ol |
| SMILES | Oc1ccc2c(c1)C(CCCC1CCCO1)NCC2 |
| InChI | InChI=1S/C16H23NO2/c18-13-7-6-12-8-9-17-16(15(12)11-13)5-1-3-14-4-2-10-19-14/h6-7,11,14,16-18H,1-5,8-10H2 |
| InChIKey | SCUVQLJLEOXECG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |