C27H27N3O2 — CID 140995915
4-(4-cyanophenyl)-N-[4-(7-hydroxy-1,2,3,4-tetrahydroisoquinolin-1-yl)butyl]benzamide (PubChem CID 140995915) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is 4-(4-cyanophenyl)-N-[4-(7-hydroxy-1,2,3,4-tetrahydroisoquinolin-1-yl)butyl]benzamide.
| Compound Name | 4-(4-cyanophenyl)-N-[4-(7-hydroxy-1,2,3,4-tetrahydroisoquinolin-1-yl)butyl]benzamide |
|---|---|
| PubChem CID | 140995915 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 4-(4-cyanophenyl)-N-[4-(7-hydroxy-1,2,3,4-tetrahydroisoquinolin-1-yl)butyl]benzamide |
| SMILES | N#Cc1ccc(-c2ccc(C(=O)NCCCCC3NCCc4ccc(O)cc43)cc2)cc1 |
| InChI | InChI=1S/C27H27N3O2/c28-18-19-4-6-20(7-5-19)21-8-10-23(11-9-21)27(32)30-15-2-1-3-26-25-17-24(31)13-12-22(25)14-16-29-26/h4-13,17,26,29,31H,1-3,14-16H2,(H,30,32) |
| InChIKey | CQFGIFFFBGGJKG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|