C20H20N2O4 — CID 101194711
N-[4-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]butyl]-4-phenylbenzamide (PubChem CID 101194711) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is N-[4-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]butyl]-4-phenylbenzamide.
| Compound Name | N-[4-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]butyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 101194711 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-[4-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]butyl]-4-phenylbenzamide |
| SMILES | O=C1N[C@@H](CCCCNC(=O)c2ccc(-c3ccccc3)cc2)C(=O)O1 |
| InChI | InChI=1S/C20H20N2O4/c23-18(21-13-5-4-8-17-19(24)26-20(25)22-17)16-11-9-15(10-12-16)14-6-2-1-3-7-14/h1-3,6-7,9-12,17H,4-5,8,13H2,(H,21,23)(H,22,25)/t17-/m0/s1 |
| InChIKey | OBYRUFWGZKZDRJ-KRWDZBQOSA-N |
| XLogP | 2.89 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|