C10H15F3N2S — CID 106784139
1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]hexan-3-amine (PubChem CID 106784139) has the molecular formula C10H15F3N2S and a molecular weight of 252.30 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]hexan-3-amine.
| Compound Name | 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]hexan-3-amine |
|---|---|
| PubChem CID | 106784139 |
| Molecular Formula | C10H15F3N2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]hexan-3-amine |
| SMILES | CCCC(N)CCc1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C10H15F3N2S/c1-2-3-7(14)4-5-8-6-15-9(16-8)10(11,12)13/h6-7H,2-5,14H2,1H3 |
| InChIKey | BITHNJSPZLYKKR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |