C12H13ClF3NS — CID 106784247
5-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-(trifluoromethyl)-1,3-thiazole (PubChem CID 106784247) has the molecular formula C12H13ClF3NS and a molecular weight of 295.76 g/mol. Its IUPAC name is 5-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-(trifluoromethyl)-1,3-thiazole.
| Compound Name | 5-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-(trifluoromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 106784247 |
| Molecular Formula | C12H13ClF3NS |
| Molecular Weight | 295.76 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 5-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-(trifluoromethyl)-1,3-thiazole |
| SMILES | CC1(C)CC(c2cnc(C(F)(F)F)s2)=CC(Cl)C1 |
| InChI | InChI=1S/C12H13ClF3NS/c1-11(2)4-7(3-8(13)5-11)9-6-17-10(18-9)12(14,15)16/h3,6,8H,4-5H2,1-2H3 |
| InChIKey | IAAFHQHROGEEFQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.76 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|