C9H11F3N2S — CID 106784472
(E)-N-methyl-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]but-3-en-1-amine (PubChem CID 106784472) has the molecular formula C9H11F3N2S and a molecular weight of 236.26 g/mol. Its IUPAC name is (E)-N-methyl-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]but-3-en-1-amine.
| Compound Name | (E)-N-methyl-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]but-3-en-1-amine |
|---|---|
| PubChem CID | 106784472 |
| Molecular Formula | C9H11F3N2S |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | (E)-N-methyl-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]but-3-en-1-amine |
| SMILES | CNCC/C=C/c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C9H11F3N2S/c1-13-5-3-2-4-7-6-14-8(15-7)9(10,11)12/h2,4,6,13H,3,5H2,1H3/b4-2+ |
| InChIKey | AQNKQRVNTNFVKE-DUXPYHPUSA-N |
| XLogP | 2.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|