C9H9F2NS — CID 145018659
5-[(1E,3E)-2,3-difluoropenta-1,3-dienyl]-2-methyl-1,3-thiazole (PubChem CID 145018659) has the molecular formula C9H9F2NS and a molecular weight of 201.24 g/mol. Its IUPAC name is 5-[(1E,3E)-2,3-difluoropenta-1,3-dienyl]-2-methyl-1,3-thiazole.
| Compound Name | 5-[(1E,3E)-2,3-difluoropenta-1,3-dienyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 145018659 |
| Molecular Formula | C9H9F2NS |
| Molecular Weight | 201.24 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 5-[(1E,3E)-2,3-difluoropenta-1,3-dienyl]-2-methyl-1,3-thiazole |
| SMILES | C/C=C(F)\C(F)=C/c1cnc(C)s1 |
| InChI | InChI=1S/C9H9F2NS/c1-3-8(10)9(11)4-7-5-12-6(2)13-7/h3-5H,1-2H3/b8-3+,9-4+ |
| InChIKey | IMQPSVFVLCERHC-BQYBEJQRSA-N |
| XLogP | 3.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|