C9H15NO3 — CID 10679087
methyl 2-(6-methyl-1-oxido-2,3,4,5-tetrahydropyridin-1-ium-2-yl)acetate (PubChem CID 10679087) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is methyl 2-(6-methyl-1-oxido-2,3,4,5-tetrahydropyridin-1-ium-2-yl)acetate.
| Compound Name | methyl 2-(6-methyl-1-oxido-2,3,4,5-tetrahydropyridin-1-ium-2-yl)acetate |
|---|---|
| PubChem CID | 10679087 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | methyl 2-(6-methyl-1-oxido-2,3,4,5-tetrahydropyridin-1-ium-2-yl)acetate |
| SMILES | COC(=O)CC1CCCC(C)=[N+]1[O-] |
| InChI | InChI=1S/C9H15NO3/c1-7-4-3-5-8(10(7)12)6-9(11)13-2/h8H,3-6H2,1-2H3 |
| InChIKey | PLGLMAYLUBWJMM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|