C10H16ClF3O — CID 106798516
1-(1-chloroethyl)-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopropane (PubChem CID 106798516) has the molecular formula C10H16ClF3O and a molecular weight of 244.68 g/mol. Its IUPAC name is 1-(1-chloroethyl)-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopropane.
| Compound Name | 1-(1-chloroethyl)-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopropane |
|---|---|
| PubChem CID | 106798516 |
| Molecular Formula | C10H16ClF3O |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-(1-chloroethyl)-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopropane |
| SMILES | CC(Cl)C1(CCCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H16ClF3O/c1-8(11)9(4-5-9)3-2-6-15-7-10(12,13)14/h8H,2-7H2,1H3 |
| InChIKey | QXORSZHGHCJMGW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|