C12H12N2O2 — CID 10680279
6-deuterio-3,4-dimethoxy-2-pyridin-2-ylpyridine (PubChem CID 10680279) has the molecular formula C12H12N2O2 and a molecular weight of 217.25 g/mol. Its IUPAC name is 6-deuterio-3,4-dimethoxy-2-pyridin-2-ylpyridine.
| Compound Name | 6-deuterio-3,4-dimethoxy-2-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 10680279 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 6-deuterio-3,4-dimethoxy-2-pyridin-2-ylpyridine |
| SMILES | [2H]c1cc(OC)c(OC)c(-c2ccccn2)n1 |
| InChI | InChI=1S/C12H12N2O2/c1-15-10-6-8-14-11(12(10)16-2)9-5-3-4-7-13-9/h3-8H,1-2H3/i8D |
| InChIKey | GWCJKCRIXOCARP-BNEYPBHNSA-N |
| XLogP | 2.16 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |