C52H40N4O4 — CID 122209982
5,10-bis[bis(4-methoxyphenyl)methylidene]-2,3-dipyridin-2-ylbenzo[g]quinoxaline (PubChem CID 122209982) has the molecular formula C52H40N4O4 and a molecular weight of 784.92 g/mol. Its IUPAC name is 5,10-bis[bis(4-methoxyphenyl)methylidene]-2,3-dipyridin-2-ylbenzo[g]quinoxaline.
| Compound Name | 5,10-bis[bis(4-methoxyphenyl)methylidene]-2,3-dipyridin-2-ylbenzo[g]quinoxaline |
|---|---|
| PubChem CID | 122209982 |
| Molecular Formula | C52H40N4O4 |
| Molecular Weight | 784.92 g/mol |
| Exact Mass | 784.30 |
| IUPAC Name | 5,10-bis[bis(4-methoxyphenyl)methylidene]-2,3-dipyridin-2-ylbenzo[g]quinoxaline |
| SMILES | COc1ccc(C(c2ccc(OC)cc2)=c2c3ccccc3c(=C(c3ccc(OC)cc3)c3ccc(OC)cc3)c3nc(-c4ccccn4)c(-c4ccccn4)nc23)cc1 |
| InChI | InChI=1S/C52H40N4O4/c1-57-37-23-15-33(16-24-37)45(34-17-25-38(58-2)26-18-34)47-41-11-5-6-12-42(41)48(46(35-19-27-39(59-3)28-20-35)36-21-29-40(60-4)30-22-36)52-51(47)55-49(43-13-7-9-31-53-43)50(56-52)44-14-8-10-32-54-44/h5-32H,1-4H3 |
| InChIKey | AAZLEZXHVZQDMW-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 88.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.92 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|