C13H12N2O3 — CID 10752787
4,5-dimethoxy-6-pyridin-2-ylpyridine-3-carbaldehyde (PubChem CID 10752787) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 4,5-dimethoxy-6-pyridin-2-ylpyridine-3-carbaldehyde.
| Compound Name | 4,5-dimethoxy-6-pyridin-2-ylpyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 10752787 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 4,5-dimethoxy-6-pyridin-2-ylpyridine-3-carbaldehyde |
| SMILES | COc1c(C=O)cnc(-c2ccccn2)c1OC |
| InChI | InChI=1S/C13H12N2O3/c1-17-12-9(8-16)7-15-11(13(12)18-2)10-5-3-4-6-14-10/h3-8H,1-2H3 |
| InChIKey | GOTIIYPRVJTQPQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|