About methoxymethane;4-methyl-3-pyridin-2-yl-1,2-oxazole-5-carbaldehyde
methoxymethane;4-methyl-3-pyridin-2-yl-1,2-oxazole-5-carbaldehyde (PubChem CID 178138128) has the molecular formula C12H14N2O3
and a molecular weight of 234.25 g/mol. Its IUPAC name is methoxymethane;4-methyl-3-pyridin-2-yl-1,2-oxazole-5-carbaldehyde.
Molecular Properties
| Compound Name | methoxymethane;4-methyl-3-pyridin-2-yl-1,2-oxazole-5-carbaldehyde |
| PubChem CID | 178138128 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | methoxymethane;4-methyl-3-pyridin-2-yl-1,2-oxazole-5-carbaldehyde |
| SMILES | COC.Cc1c(-c2ccccn2)noc1C=O |
| InChI | InChI=1S/C10H8N2O2.C2H6O/c1-7-9(6-13)14-12-10(7)8-4-2-3-5-11-8;1-3-2/h2-6H,1H3;1-2H3 |
| InChIKey | FJVJBFMAQSBGMX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methoxymethane;4-methyl-3-pyridin-2-yl-1,2-oxazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;4-methyl-3-pyridin-2-yl-1,2-oxazole-5-carbaldehyde?
The IUPAC name of methoxymethane;4-methyl-3-pyridin-2-yl-1,2-oxazole-5-carbaldehyde (CID 178138128) is methoxymethane;4-methyl-3-pyridin-2-yl-1,2-oxazole-5-carbaldehyde.
What is the SMILES notation for methoxymethane;4-methyl-3-pyridin-2-yl-1,2-oxazole-5-carbaldehyde?
The canonical SMILES for methoxymethane;4-methyl-3-pyridin-2-yl-1,2-oxazole-5-carbaldehyde is COC.Cc1c(-c2ccccn2)noc1C=O.
What is the InChIKey of methoxymethane;4-methyl-3-pyridin-2-yl-1,2-oxazole-5-carbaldehyde?
The InChIKey is FJVJBFMAQSBGMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2.C2H6O/c1-7-9(6-13)14-12-10(7)8-4-2-3-5-11-8;1-3-2/h2-6H,1H3;1-2H3.
What are the key properties of methoxymethane;4-methyl-3-pyridin-2-yl-1,2-oxazole-5-carbaldehyde?
methoxymethane;4-methyl-3-pyridin-2-yl-1,2-oxazole-5-carbaldehyde has a molecular weight of 234.25 g/mol, XLogP of 2.12, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;4-methyl-3-pyridin-2-yl-1,2-oxazole-5-carbaldehyde is sourced from PubChem (CID 178138128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).