C12H14N2O3 — CID 178138128
methoxymethane;4-methyl-3-pyridin-2-yl-1,2-oxazole-5-carbaldehyde (PubChem CID 178138128) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is methoxymethane;4-methyl-3-pyridin-2-yl-1,2-oxazole-5-carbaldehyde.
| Compound Name | methoxymethane;4-methyl-3-pyridin-2-yl-1,2-oxazole-5-carbaldehyde |
|---|---|
| PubChem CID | 178138128 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | methoxymethane;4-methyl-3-pyridin-2-yl-1,2-oxazole-5-carbaldehyde |
| SMILES | COC.Cc1c(-c2ccccn2)noc1C=O |
| InChI | InChI=1S/C10H8N2O2.C2H6O/c1-7-9(6-13)14-12-10(7)8-4-2-3-5-11-8;1-3-2/h2-6H,1H3;1-2H3 |
| InChIKey | FJVJBFMAQSBGMX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|