C12H19N3O2S — CID 106807473
2-amino-2-ethyl-5-(4-methylpyrimidin-2-yl)sulfanylpentanoic acid (PubChem CID 106807473) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-amino-2-ethyl-5-(4-methylpyrimidin-2-yl)sulfanylpentanoic acid.
| Compound Name | 2-amino-2-ethyl-5-(4-methylpyrimidin-2-yl)sulfanylpentanoic acid |
|---|---|
| PubChem CID | 106807473 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-amino-2-ethyl-5-(4-methylpyrimidin-2-yl)sulfanylpentanoic acid |
| SMILES | CCC(N)(CCCSc1nccc(C)n1)C(=O)O |
| InChI | InChI=1S/C12H19N3O2S/c1-3-12(13,10(16)17)6-4-8-18-11-14-7-5-9(2)15-11/h5,7H,3-4,6,8,13H2,1-2H3,(H,16,17) |
| InChIKey | CTFMMQQVJLQCCG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|