C11H17ClN2S — CID 62268363
2-(6-chlorohexylsulfanyl)-4-methylpyrimidine (PubChem CID 62268363) has the molecular formula C11H17ClN2S and a molecular weight of 244.79 g/mol. Its IUPAC name is 2-(6-chlorohexylsulfanyl)-4-methylpyrimidine.
| Compound Name | 2-(6-chlorohexylsulfanyl)-4-methylpyrimidine |
|---|---|
| PubChem CID | 62268363 |
| Molecular Formula | C11H17ClN2S |
| Molecular Weight | 244.79 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-(6-chlorohexylsulfanyl)-4-methylpyrimidine |
| SMILES | Cc1ccnc(SCCCCCCCl)n1 |
| InChI | InChI=1S/C11H17ClN2S/c1-10-6-8-13-11(14-10)15-9-5-3-2-4-7-12/h6,8H,2-5,7,9H2,1H3 |
| InChIKey | UWGWXILVYNDVQT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.79 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|